C18H27N3O5S — CID 113146688
ethyl 2-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-methylsulfonylamino]benzoate (PubChem CID 113146688) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 2-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-methylsulfonylamino]benzoate.
| Compound Name | ethyl 2-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 113146688 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | ethyl 2-[[3-(4-methylpiperazin-1-yl)-3-oxopropyl]-methylsulfonylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CCC(=O)N1CCN(C)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C18H27N3O5S/c1-4-26-18(23)15-7-5-6-8-16(15)21(27(3,24)25)10-9-17(22)20-13-11-19(2)12-14-20/h5-8H,4,9-14H2,1-3H3 |
| InChIKey | ACKMZUJISQVHMG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |