C17H17F3N2O3S — CID 113147087
N-methyl-N-phenyl-3-(2,3,4-trifluoro-N-methylsulfonylanilino)propanamide (PubChem CID 113147087) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-methyl-N-phenyl-3-(2,3,4-trifluoro-N-methylsulfonylanilino)propanamide.
| Compound Name | N-methyl-N-phenyl-3-(2,3,4-trifluoro-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113147087 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-methyl-N-phenyl-3-(2,3,4-trifluoro-N-methylsulfonylanilino)propanamide |
| SMILES | CN(C(=O)CCN(c1ccc(F)c(F)c1F)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C17H17F3N2O3S/c1-21(12-6-4-3-5-7-12)15(23)10-11-22(26(2,24)25)14-9-8-13(18)16(19)17(14)20/h3-9H,10-11H2,1-2H3 |
| InChIKey | VVRIVESYQNBWBT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|