C16H26N2O3S — CID 113141498
3-(N-methylsulfonylanilino)-N,N-dipropylpropanamide (PubChem CID 113141498) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 3-(N-methylsulfonylanilino)-N,N-dipropylpropanamide.
| Compound Name | 3-(N-methylsulfonylanilino)-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 113141498 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-(N-methylsulfonylanilino)-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O3S/c1-4-12-17(13-5-2)16(19)11-14-18(22(3,20)21)15-9-7-6-8-10-15/h6-10H,4-5,11-14H2,1-3H3 |
| InChIKey | OTTVNGPMVFYJOA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |