C13H28N2O3S — CID 113135931
3-[methylsulfonyl(propyl)amino]-N,N-dipropylpropanamide (PubChem CID 113135931) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is 3-[methylsulfonyl(propyl)amino]-N,N-dipropylpropanamide.
| Compound Name | 3-[methylsulfonyl(propyl)amino]-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 113135931 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[methylsulfonyl(propyl)amino]-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCN(CCC)S(C)(=O)=O |
| InChI | InChI=1S/C13H28N2O3S/c1-5-9-14(10-6-2)13(16)8-12-15(11-7-3)19(4,17)18/h5-12H2,1-4H3 |
| InChIKey | FCZKYKKAPLDXCI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |