C17H25F3N2O3S — CID 113145294
3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]-N,N-dipropylpropanamide (PubChem CID 113145294) has the molecular formula C17H25F3N2O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]-N,N-dipropylpropanamide.
| Compound Name | 3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 113145294 |
| Molecular Formula | C17H25F3N2O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-[N-methylsulfonyl-4-(trifluoromethyl)anilino]-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCN(c1ccc(C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H25F3N2O3S/c1-4-11-21(12-5-2)16(23)10-13-22(26(3,24)25)15-8-6-14(7-9-15)17(18,19)20/h6-9H,4-5,10-13H2,1-3H3 |
| InChIKey | SHDJTQQVYVDINF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |