C11H15F3N2O4S2 — CID 113070952
N-[2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]ethyl]methanesulfonamide (PubChem CID 113070952) has the molecular formula C11H15F3N2O4S2 and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113070952 |
| Molecular Formula | C11H15F3N2O4S2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | N-[2-[N-methylsulfonyl-4-(trifluoromethyl)anilino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(c1ccc(C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C11H15F3N2O4S2/c1-21(17,18)15-7-8-16(22(2,19)20)10-5-3-9(4-6-10)11(12,13)14/h3-6,15H,7-8H2,1-2H3 |
| InChIKey | DAOXAHFYHBLIGR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |