C15H17F2N3O3 — CID 113181393
N-(2,6-difluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide (PubChem CID 113181393) has the molecular formula C15H17F2N3O3 and a molecular weight of 325.31 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113181393 |
| Molecular Formula | C15H17F2N3O3 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-(2,6-difluorophenyl)-N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCN(C=O)CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H17F2N3O3/c1-11(22)20(15-12(16)3-2-4-13(15)17)9-14(23)19-7-5-18(10-21)6-8-19/h2-4,10H,5-9H2,1H3 |
| InChIKey | ZODWLORQDIBQKE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|