C16H26N2O5S — CID 113145132
N-butan-2-yl-3-(2,4-dimethoxy-N-methylsulfonylanilino)propanamide (PubChem CID 113145132) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is N-butan-2-yl-3-(2,4-dimethoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | N-butan-2-yl-3-(2,4-dimethoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 113145132 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-butan-2-yl-3-(2,4-dimethoxy-N-methylsulfonylanilino)propanamide |
| SMILES | CCC(C)NC(=O)CCN(c1ccc(OC)cc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C16H26N2O5S/c1-6-12(2)17-16(19)9-10-18(24(5,20)21)14-8-7-13(22-3)11-15(14)23-4/h7-8,11-12H,6,9-10H2,1-5H3,(H,17,19) |
| InChIKey | MKVXGBUDUJITCH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |