C24H36NP — CID 11314683
(2S)-3-[bis(1-adamantyl)phosphanyl]-2-methylpropanenitrile (PubChem CID 11314683) has the molecular formula C24H36NP and a molecular weight of 369.53 g/mol. Its IUPAC name is (2S)-3-[bis(1-adamantyl)phosphanyl]-2-methylpropanenitrile.
| Compound Name | (2S)-3-[bis(1-adamantyl)phosphanyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 11314683 |
| Molecular Formula | C24H36NP |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | (2S)-3-[bis(1-adamantyl)phosphanyl]-2-methylpropanenitrile |
| SMILES | C[C@@H](C#N)CP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H36NP/c1-16(14-25)15-26(23-8-17-2-18(9-23)4-19(3-17)10-23)24-11-20-5-21(12-24)7-22(6-20)13-24/h16-22H,2-13,15H2,1H3/t16-,17?,18?,19?,20?,21?,22?,23?,24?,26?/m0/s1 |
| InChIKey | BOPRFQJWFZMMJK-XUKZRRQTSA-N |
| XLogP | 6.57 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|