C27H44NaO4PS — CID 58174783
sodium 3-[3-[bis(1-adamantyl)phosphanyl]-2-methylpropoxy]propane-1-sulfonate (PubChem CID 58174783) has the molecular formula C27H44NaO4PS and a molecular weight of 518.68 g/mol. Its IUPAC name is sodium 3-[3-[bis(1-adamantyl)phosphanyl]-2-methylpropoxy]propane-1-sulfonate.
| Compound Name | sodium 3-[3-[bis(1-adamantyl)phosphanyl]-2-methylpropoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 58174783 |
| Molecular Formula | C27H44NaO4PS |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | sodium 3-[3-[bis(1-adamantyl)phosphanyl]-2-methylpropoxy]propane-1-sulfonate |
| SMILES | CC(COCCCS(=O)(=O)[O-])CP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C27H45O4PS.Na/c1-19(17-31-3-2-4-33(28,29)30)18-32(26-11-20-5-21(12-26)7-22(6-20)13-26)27-14-23-8-24(15-27)10-25(9-23)16-27;/h19-25H,2-18H2,1H3,(H,28,29,30);/q;+1/p-1 |
| InChIKey | WTJQNBKQZGSFLS-UHFFFAOYSA-M |
| XLogP | 3.00 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|