C14H23N2NaO4S — CID 23687463
sodium 3-(1-adamantylcarbamoylamino)propane-1-sulfonate (PubChem CID 23687463) has the molecular formula C14H23N2NaO4S and a molecular weight of 338.41 g/mol. Its IUPAC name is sodium 3-(1-adamantylcarbamoylamino)propane-1-sulfonate.
| Compound Name | sodium 3-(1-adamantylcarbamoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 23687463 |
| Molecular Formula | C14H23N2NaO4S |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | sodium 3-(1-adamantylcarbamoylamino)propane-1-sulfonate |
| SMILES | O=C(NCCCS(=O)(=O)[O-])NC12CC3CC(CC(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C14H24N2O4S.Na/c17-13(15-2-1-3-21(18,19)20)16-14-7-10-4-11(8-14)6-12(5-10)9-14;/h10-12H,1-9H2,(H2,15,16,17)(H,18,19,20);/q;+1/p-1 |
| InChIKey | JKXKCFSEMBZOJE-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|