C10H19NaO6S2 — CID 140700101
sodium 3-(4-methylsulfonylcyclohexyl)oxypropane-1-sulfonate (PubChem CID 140700101) has the molecular formula C10H19NaO6S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is sodium 3-(4-methylsulfonylcyclohexyl)oxypropane-1-sulfonate.
| Compound Name | sodium 3-(4-methylsulfonylcyclohexyl)oxypropane-1-sulfonate |
|---|---|
| PubChem CID | 140700101 |
| Molecular Formula | C10H19NaO6S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | sodium 3-(4-methylsulfonylcyclohexyl)oxypropane-1-sulfonate |
| SMILES | CS(=O)(=O)C1CCC(OCCCS(=O)(=O)[O-])CC1.[Na+] |
| InChI | InChI=1S/C10H20O6S2.Na/c1-17(11,12)10-5-3-9(4-6-10)16-7-2-8-18(13,14)15;/h9-10H,2-8H2,1H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | IMSQWBIPGUPQFH-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|