C10H20O5S2 — CID 140700086
3-(4-methylsulfanyloxycyclohexyl)oxypropane-1-sulfonic acid (PubChem CID 140700086) has the molecular formula C10H20O5S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-(4-methylsulfanyloxycyclohexyl)oxypropane-1-sulfonic acid.
| Compound Name | 3-(4-methylsulfanyloxycyclohexyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 140700086 |
| Molecular Formula | C10H20O5S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(4-methylsulfanyloxycyclohexyl)oxypropane-1-sulfonic acid |
| SMILES | CSOC1CCC(OCCCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C10H20O5S2/c1-16-15-10-5-3-9(4-6-10)14-7-2-8-17(11,12)13/h9-10H,2-8H2,1H3,(H,11,12,13) |
| InChIKey | OCCBTSKYLMJACX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|