C17H15FN4O3S — CID 11314814
4-[(5-fluoro-3-pyridinyl)amino]-8-methyl-6-methylsulfonylquinoline-3-carboxamide (PubChem CID 11314814) has the molecular formula C17H15FN4O3S and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[(5-fluoro-3-pyridinyl)amino]-8-methyl-6-methylsulfonylquinoline-3-carboxamide.
| Compound Name | 4-[(5-fluoro-3-pyridinyl)amino]-8-methyl-6-methylsulfonylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11314814 |
| Molecular Formula | C17H15FN4O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-[(5-fluoro-3-pyridinyl)amino]-8-methyl-6-methylsulfonylquinoline-3-carboxamide |
| SMILES | Cc1cc(S(C)(=O)=O)cc2c(Nc3cncc(F)c3)c(C(N)=O)cnc12 |
| InChI | InChI=1S/C17H15FN4O3S/c1-9-3-12(26(2,24)25)5-13-15(9)21-8-14(17(19)23)16(13)22-11-4-10(18)6-20-7-11/h3-8H,1-2H3,(H2,19,23)(H,21,22) |
| InChIKey | UTRUFDYSKJPERE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |