C17H22ClFN2O3S — CID 113149187
N-(3-chloro-4-fluorophenyl)-2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]acetamide (PubChem CID 113149187) has the molecular formula C17H22ClFN2O3S and a molecular weight of 388.89 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]acetamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]acetamide |
|---|---|
| PubChem CID | 113149187 |
| Molecular Formula | C17H22ClFN2O3S |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]acetamide |
| SMILES | CS(=O)(=O)N(CCC1=CCCCC1)CC(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H22ClFN2O3S/c1-25(23,24)21(10-9-13-5-3-2-4-6-13)12-17(22)20-14-7-8-16(19)15(18)11-14/h5,7-8,11H,2-4,6,9-10,12H2,1H3,(H,20,22) |
| InChIKey | LYUGZTXXDFGODW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|