C14H20N2O6S — CID 113149369
methyl 3-[[2-[2-methoxyethyl(methylsulfonyl)amino]acetyl]amino]benzoate (PubChem CID 113149369) has the molecular formula C14H20N2O6S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 3-[[2-[2-methoxyethyl(methylsulfonyl)amino]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[2-methoxyethyl(methylsulfonyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 113149369 |
| Molecular Formula | C14H20N2O6S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 3-[[2-[2-methoxyethyl(methylsulfonyl)amino]acetyl]amino]benzoate |
| SMILES | COCCN(CC(=O)Nc1cccc(C(=O)OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H20N2O6S/c1-21-8-7-16(23(3,19)20)10-13(17)15-12-6-4-5-11(9-12)14(18)22-2/h4-6,9H,7-8,10H2,1-3H3,(H,15,17) |
| InChIKey | QBBUDHNECLNCNX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |