C20H23N3O6S — CID 56539827
methyl 4-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 56539827) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 4-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 4-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 56539827 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | methyl 4-[[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN(c2ccc(C(=O)OC)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-4-21-19(25)15-6-5-7-16(12-15)22-18(24)13-23(30(3,27)28)17-10-8-14(9-11-17)20(26)29-2/h5-12H,4,13H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | NDWBLLKXLCAQNW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |