C20H23N3O6S — CID 56539828
methyl 4-[[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 56539828) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is methyl 4-[[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 4-[[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 56539828 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | methyl 4-[[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)Nc2ccc(C(=O)N(C)C)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H23N3O6S/c1-22(2)19(25)14-5-9-16(10-6-14)21-18(24)13-23(30(4,27)28)17-11-7-15(8-12-17)20(26)29-3/h5-12H,13H2,1-4H3,(H,21,24) |
| InChIKey | ZHBPMQFYSBCMHE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |