C12H16N2O5S — CID 30464552
methyl 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]benzoate (PubChem CID 30464552) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30464552 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 4-[[2-[methyl(methylsulfonyl)amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN(C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H16N2O5S/c1-14(20(3,17)18)8-11(15)13-10-6-4-9(5-7-10)12(16)19-2/h4-7H,8H2,1-3H3,(H,13,15) |
| InChIKey | FEBBUMZXFAKGCT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |