C16H22N2O5 — CID 139612587
methyl 4-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]benzoate (PubChem CID 139612587) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 4-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 139612587 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | methyl 4-[[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N2O5/c1-16(2,3)23-15(21)18(4)10-13(19)17-12-8-6-11(7-9-12)14(20)22-5/h6-9H,10H2,1-5H3,(H,17,19) |
| InChIKey | OZFIBILEHHUUBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |