C28H34N2O3S — CID 156652823
tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-methylcarbamate;toluene (PubChem CID 156652823) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-methylcarbamate;toluene.
| Compound Name | tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-methylcarbamate;toluene |
|---|---|
| PubChem CID | 156652823 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-methylcarbamate;toluene |
| SMILES | CN(CC(=O)Nc1ccc(SCc2ccccc2)cc1)C(=O)OC(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O3S.C7H8/c1-21(2,3)26-20(25)23(4)14-19(24)22-17-10-12-18(13-11-17)27-15-16-8-6-5-7-9-16;1-7-5-3-2-4-6-7/h5-13H,14-15H2,1-4H3,(H,22,24);2-6H,1H3 |
| InChIKey | DTEQCWAAHGMMDQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |