C29H36N2O3S — CID 156652708
tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-ethylcarbamate;toluene (PubChem CID 156652708) has the molecular formula C29H36N2O3S and a molecular weight of 492.69 g/mol. Its IUPAC name is tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-ethylcarbamate;toluene.
| Compound Name | tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-ethylcarbamate;toluene |
|---|---|
| PubChem CID | 156652708 |
| Molecular Formula | C29H36N2O3S |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | tert-butyl N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-N-ethylcarbamate;toluene |
| SMILES | CCN(CC(=O)Nc1ccc(SCc2ccccc2)cc1)C(=O)OC(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O3S.C7H8/c1-5-24(21(26)27-22(2,3)4)15-20(25)23-18-11-13-19(14-12-18)28-16-17-9-7-6-8-10-17;1-7-5-3-2-4-6-7/h6-14H,5,15-16H2,1-4H3,(H,23,25);2-6H,1H3 |
| InChIKey | PDEAEUQIVIDAEC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |