C30H29FN2O2S — CID 156652583
N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-4-fluoro-N-methylbenzamide;toluene (PubChem CID 156652583) has the molecular formula C30H29FN2O2S and a molecular weight of 500.64 g/mol. Its IUPAC name is N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-4-fluoro-N-methylbenzamide;toluene.
| Compound Name | N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-4-fluoro-N-methylbenzamide;toluene |
|---|---|
| PubChem CID | 156652583 |
| Molecular Formula | C30H29FN2O2S |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | N-[2-(4-benzylsulfanylanilino)-2-oxoethyl]-4-fluoro-N-methylbenzamide;toluene |
| SMILES | CN(CC(=O)Nc1ccc(SCc2ccccc2)cc1)C(=O)c1ccc(F)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C23H21FN2O2S.C7H8/c1-26(23(28)18-7-9-19(24)10-8-18)15-22(27)25-20-11-13-21(14-12-20)29-16-17-5-3-2-4-6-17;1-7-5-3-2-4-6-7/h2-14H,15-16H2,1H3,(H,25,27);2-6H,1H3 |
| InChIKey | AZTYQSPIGYNQNS-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |