C33H37FN2O2S — CID 156652832
N-(4-benzylsulfanylphenyl)formamide;ethane;4-fluoro-N-methyl-N-(1-phenylpropan-2-yl)benzamide (PubChem CID 156652832) has the molecular formula C33H37FN2O2S and a molecular weight of 544.74 g/mol. Its IUPAC name is N-(4-benzylsulfanylphenyl)formamide;ethane;4-fluoro-N-methyl-N-(1-phenylpropan-2-yl)benzamide.
| Compound Name | N-(4-benzylsulfanylphenyl)formamide;ethane;4-fluoro-N-methyl-N-(1-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 156652832 |
| Molecular Formula | C33H37FN2O2S |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | N-(4-benzylsulfanylphenyl)formamide;ethane;4-fluoro-N-methyl-N-(1-phenylpropan-2-yl)benzamide |
| SMILES | CC.CC(Cc1ccccc1)N(C)C(=O)c1ccc(F)cc1.O=CNc1ccc(SCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18FNO.C14H13NOS.C2H6/c1-13(12-14-6-4-3-5-7-14)19(2)17(20)15-8-10-16(18)11-9-15;16-11-15-13-6-8-14(9-7-13)17-10-12-4-2-1-3-5-12;1-2/h3-11,13H,12H2,1-2H3;1-9,11H,10H2,(H,15,16);1-2H3 |
| InChIKey | IJONLOBJXCVQJY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|