C31H31FN2O3S — CID 156652788
N-(4-benzylsulfanyl-3-methoxyphenyl)formamide;4-fluoro-N-(1-phenylpropan-2-yl)benzamide (PubChem CID 156652788) has the molecular formula C31H31FN2O3S and a molecular weight of 530.67 g/mol. Its IUPAC name is N-(4-benzylsulfanyl-3-methoxyphenyl)formamide;4-fluoro-N-(1-phenylpropan-2-yl)benzamide.
| Compound Name | N-(4-benzylsulfanyl-3-methoxyphenyl)formamide;4-fluoro-N-(1-phenylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 156652788 |
| Molecular Formula | C31H31FN2O3S |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | N-(4-benzylsulfanyl-3-methoxyphenyl)formamide;4-fluoro-N-(1-phenylpropan-2-yl)benzamide |
| SMILES | CC(Cc1ccccc1)NC(=O)c1ccc(F)cc1.COc1cc(NC=O)ccc1SCc1ccccc1 |
| InChI | InChI=1S/C16H16FNO.C15H15NO2S/c1-12(11-13-5-3-2-4-6-13)18-16(19)14-7-9-15(17)10-8-14;1-18-14-9-13(16-11-17)7-8-15(14)19-10-12-5-3-2-4-6-12/h2-10,12H,11H2,1H3,(H,18,19);2-9,11H,10H2,1H3,(H,16,17) |
| InChIKey | ZTHAAQBCWHXGJH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|