C21H23N3O6S — CID 56539474
methyl 4-[methylsulfonyl-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl]amino]benzoate (PubChem CID 56539474) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is methyl 4-[methylsulfonyl-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl]amino]benzoate.
| Compound Name | methyl 4-[methylsulfonyl-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl]amino]benzoate |
|---|---|
| PubChem CID | 56539474 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | methyl 4-[methylsulfonyl-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)anilino]ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)Nc2cccc(N3CCCC3=O)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c1-30-21(27)15-8-10-17(11-9-15)24(31(2,28)29)14-19(25)22-16-5-3-6-18(13-16)23-12-4-7-20(23)26/h3,5-6,8-11,13H,4,7,12,14H2,1-2H3,(H,22,25) |
| InChIKey | YDAZHWMMRLKTSB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |