C23H29N3O2 — CID 11314984
3-[2-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4-methylbenzamide (PubChem CID 11314984) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-[2-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[2-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 11314984 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 3-[2-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-c1ccc(C(=O)NCC(C)(C)C)cc1N |
| InChI | InChI=1S/C23H29N3O2/c1-14-5-6-15(22(28)26-17-8-9-17)11-19(14)18-10-7-16(12-20(18)24)21(27)25-13-23(2,3)4/h5-7,10-12,17H,8-9,13,24H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | AWEHNYQLGGJUGD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|