C24H31N3O2 — CID 135294127
3-[3-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4,5-dimethylbenzamide (PubChem CID 135294127) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-[3-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4,5-dimethylbenzamide.
| Compound Name | 3-[3-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 135294127 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 3-[3-amino-4-(2,2-dimethylpropylcarbamoyl)phenyl]-N-cyclopropyl-4,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC2)cc(-c2ccc(C(=O)NCC(C)(C)C)c(N)c2)c1C |
| InChI | InChI=1S/C24H31N3O2/c1-14-10-17(22(28)27-18-7-8-18)11-20(15(14)2)16-6-9-19(21(25)12-16)23(29)26-13-24(3,4)5/h6,9-12,18H,7-8,13,25H2,1-5H3,(H,26,29)(H,27,28) |
| InChIKey | QPLQZBJILNDXLD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|