C27H25Cl2N3O2 — CID 89031459
3-[3-amino-4-[(3,4-dichlorophenyl)methyl-ethenylcarbamoyl]phenyl]-N-cyclopropyl-4-methylbenzamide (PubChem CID 89031459) has the molecular formula C27H25Cl2N3O2 and a molecular weight of 494.42 g/mol. Its IUPAC name is 3-[3-amino-4-[(3,4-dichlorophenyl)methyl-ethenylcarbamoyl]phenyl]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[3-amino-4-[(3,4-dichlorophenyl)methyl-ethenylcarbamoyl]phenyl]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 89031459 |
| Molecular Formula | C27H25Cl2N3O2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[3-amino-4-[(3,4-dichlorophenyl)methyl-ethenylcarbamoyl]phenyl]-N-cyclopropyl-4-methylbenzamide |
| SMILES | C=CN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(-c2cc(C(=O)NC3CC3)ccc2C)cc1N |
| InChI | InChI=1S/C27H25Cl2N3O2/c1-3-32(15-17-5-11-23(28)24(29)12-17)27(34)21-10-7-18(14-25(21)30)22-13-19(6-4-16(22)2)26(33)31-20-8-9-20/h3-7,10-14,20H,1,8-9,15,30H2,2H3,(H,31,33) |
| InChIKey | ACDNGMKIFGUVCG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|