About 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide
3-bromo-N-cyclopropyl-4,5-dimethylbenzamide (PubChem CID 18457798) has the molecular formula C12H14BrNO
and a molecular weight of 268.15 g/mol. Its IUPAC name is 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide |
| PubChem CID | 18457798 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC2)cc(Br)c1C |
| InChI | InChI=1S/C12H14BrNO/c1-7-5-9(6-11(13)8(7)2)12(15)14-10-3-4-10/h5-6,10H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | JEOUOQZZPWILAH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide?
The IUPAC name of 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide (CID 18457798) is 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide.
What is the SMILES notation for 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide?
The canonical SMILES for 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide is Cc1cc(C(=O)NC2CC2)cc(Br)c1C.
What is the InChIKey of 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide?
The InChIKey is JEOUOQZZPWILAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO/c1-7-5-9(6-11(13)8(7)2)12(15)14-10-3-4-10/h5-6,10H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide?
3-bromo-N-cyclopropyl-4,5-dimethylbenzamide has a molecular weight of 268.15 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-cyclopropyl-4,5-dimethylbenzamide is sourced from PubChem (CID 18457798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).