C11H14BNO3 — CID 129359426
[4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid (PubChem CID 129359426) has the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. Its IUPAC name is [4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid.
| Compound Name | [4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 129359426 |
| Molecular Formula | C11H14BNO3 |
| Molecular Weight | 219.05 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | [4-(cyclopropylcarbamoyl)-2-methylphenyl]boronic acid |
| SMILES | Cc1cc(C(=O)NC2CC2)ccc1B(O)O |
| InChI | InChI=1S/C11H14BNO3/c1-7-6-8(2-5-10(7)12(15)16)11(14)13-9-3-4-9/h2,5-6,9,15-16H,3-4H2,1H3,(H,13,14) |
| InChIKey | IUZIQDNNJBRXRL-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.05 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|