C16H25BN2O3 — CID 140735009
[4-[[4-(dimethylamino)cyclohexyl]carbamoyl]-2-methylphenyl]boronic acid (PubChem CID 140735009) has the molecular formula C16H25BN2O3 and a molecular weight of 304.20 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)cyclohexyl]carbamoyl]-2-methylphenyl]boronic acid.
| Compound Name | [4-[[4-(dimethylamino)cyclohexyl]carbamoyl]-2-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 140735009 |
| Molecular Formula | C16H25BN2O3 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [4-[[4-(dimethylamino)cyclohexyl]carbamoyl]-2-methylphenyl]boronic acid |
| SMILES | Cc1cc(C(=O)NC2CCC(N(C)C)CC2)ccc1B(O)O |
| InChI | InChI=1S/C16H25BN2O3/c1-11-10-12(4-9-15(11)17(21)22)16(20)18-13-5-7-14(8-6-13)19(2)3/h4,9-10,13-14,21-22H,5-8H2,1-3H3,(H,18,20) |
| InChIKey | RYDXXASACWBXNW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|