C19H18BrF2NO3 — CID 161026057
3-bromo-N-cyclopropyl-5-fluoro-4-methylbenzamide;3-fluoro-4-methylbenzoic acid (PubChem CID 161026057) has the molecular formula C19H18BrF2NO3 and a molecular weight of 426.26 g/mol. Its IUPAC name is 3-bromo-N-cyclopropyl-5-fluoro-4-methylbenzamide;3-fluoro-4-methylbenzoic acid.
| Compound Name | 3-bromo-N-cyclopropyl-5-fluoro-4-methylbenzamide;3-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 161026057 |
| Molecular Formula | C19H18BrF2NO3 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 3-bromo-N-cyclopropyl-5-fluoro-4-methylbenzamide;3-fluoro-4-methylbenzoic acid |
| SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1Br.Cc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C11H11BrFNO.C8H7FO2/c1-6-9(12)4-7(5-10(6)13)11(15)14-8-2-3-8;1-5-2-3-6(8(10)11)4-7(5)9/h4-5,8H,2-3H2,1H3,(H,14,15);2-4H,1H3,(H,10,11) |
| InChIKey | TYZILFTUBZIKGT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |