C21H25N3O — CID 91134825
N-cyclopropyl-3-(1H-indazol-5-yl)-4,5-dimethylbenzamide;ethane (PubChem CID 91134825) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is N-cyclopropyl-3-(1H-indazol-5-yl)-4,5-dimethylbenzamide;ethane.
| Compound Name | N-cyclopropyl-3-(1H-indazol-5-yl)-4,5-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 91134825 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N-cyclopropyl-3-(1H-indazol-5-yl)-4,5-dimethylbenzamide;ethane |
| SMILES | CC.Cc1cc(C(=O)NC2CC2)cc(-c2ccc3[nH]ncc3c2)c1C |
| InChI | InChI=1S/C19H19N3O.C2H6/c1-11-7-14(19(23)21-16-4-5-16)9-17(12(11)2)13-3-6-18-15(8-13)10-20-22-18;1-2/h3,6-10,16H,4-5H2,1-2H3,(H,20,22)(H,21,23);1-2H3 |
| InChIKey | WXYYHHSYPKBVFX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |