C17H27N3O5S — CID 113149986
N-[(4-methoxyphenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide (PubChem CID 113149986) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 113149986 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide |
| SMILES | COc1ccc(CNC(=O)CN(CCN2CCOCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H27N3O5S/c1-24-16-5-3-15(4-6-16)13-18-17(21)14-20(26(2,22)23)8-7-19-9-11-25-12-10-19/h3-6H,7-14H2,1-2H3,(H,18,21) |
| InChIKey | FZPUGEIPSYGBDU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |