C16H24ClN3O4S — CID 113149983
N-[(2-chlorophenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide (PubChem CID 113149983) has the molecular formula C16H24ClN3O4S and a molecular weight of 389.91 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 113149983 |
| Molecular Formula | C16H24ClN3O4S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]acetamide |
| SMILES | CS(=O)(=O)N(CCN1CCOCC1)CC(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C16H24ClN3O4S/c1-25(22,23)20(7-6-19-8-10-24-11-9-19)13-16(21)18-12-14-4-2-3-5-15(14)17/h2-5H,6-13H2,1H3,(H,18,21) |
| InChIKey | GYUNWEANLHEFQC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |