C16H30N2O3S — CID 113153097
N-[2-(azepan-1-yl)-2-oxoethyl]-N-cycloheptylmethanesulfonamide (PubChem CID 113153097) has the molecular formula C16H30N2O3S and a molecular weight of 330.49 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-oxoethyl]-N-cycloheptylmethanesulfonamide.
| Compound Name | N-[2-(azepan-1-yl)-2-oxoethyl]-N-cycloheptylmethanesulfonamide |
|---|---|
| PubChem CID | 113153097 |
| Molecular Formula | C16H30N2O3S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-oxoethyl]-N-cycloheptylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCCCCC1)C1CCCCCC1 |
| InChI | InChI=1S/C16H30N2O3S/c1-22(20,21)18(15-10-6-2-3-7-11-15)14-16(19)17-12-8-4-5-9-13-17/h15H,2-14H2,1H3 |
| InChIKey | WHDJDDWWMOYGQU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |