C18H28N4O3S — CID 113149044
N-cyclohexyl-N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide (PubChem CID 113149044) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide.
| Compound Name | N-cyclohexyl-N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113149044 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-cyclohexyl-N-[2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCN(c2ccccn2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C18H28N4O3S/c1-26(24,25)22(16-7-3-2-4-8-16)15-18(23)21-13-11-20(12-14-21)17-9-5-6-10-19-17/h5-6,9-10,16H,2-4,7-8,11-15H2,1H3 |
| InChIKey | UBIYESWJWAIJOQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |