C18H26N4O2 — CID 108503873
N-cyclohexyl-N-methyl-2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide (PubChem CID 108503873) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide.
| Compound Name | N-cyclohexyl-N-methyl-2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 108503873 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-cyclohexyl-N-methyl-2-oxo-2-(4-pyridin-2-ylpiperazin-1-yl)acetamide |
| SMILES | CN(C(=O)C(=O)N1CCN(c2ccccn2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C18H26N4O2/c1-20(15-7-3-2-4-8-15)17(23)18(24)22-13-11-21(12-14-22)16-9-5-6-10-19-16/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3 |
| InChIKey | YSNXWOZZNXFTCS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|