C14H20Cl2N2O3S — CID 113153356
N-(2,6-dichlorophenyl)-2-[3-methylbutyl(methylsulfonyl)amino]acetamide (PubChem CID 113153356) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[3-methylbutyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[3-methylbutyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 113153356 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[3-methylbutyl(methylsulfonyl)amino]acetamide |
| SMILES | CC(C)CCN(CC(=O)Nc1c(Cl)cccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C14H20Cl2N2O3S/c1-10(2)7-8-18(22(3,20)21)9-13(19)17-14-11(15)5-4-6-12(14)16/h4-6,10H,7-9H2,1-3H3,(H,17,19) |
| InChIKey | DRHBFWYTYDYPMA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |