C18H22ClN3O3S — CID 113154877
2-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 113154877) has the molecular formula C18H22ClN3O3S and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 113154877 |
| Molecular Formula | C18H22ClN3O3S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-methyl-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | Cc1c(Cl)cccc1N(CC(=O)N(C)CCc1ccncc1)S(C)(=O)=O |
| InChI | InChI=1S/C18H22ClN3O3S/c1-14-16(19)5-4-6-17(14)22(26(3,24)25)13-18(23)21(2)12-9-15-7-10-20-11-8-15/h4-8,10-11H,9,12-13H2,1-3H3 |
| InChIKey | CKNRKLUYMZHPBZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |