C16H23N3O5S — CID 113156021
methyl 4-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-methylsulfonylamino]benzoate (PubChem CID 113156021) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is methyl 4-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-methylsulfonylamino]benzoate.
| Compound Name | methyl 4-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-methylsulfonylamino]benzoate |
|---|---|
| PubChem CID | 113156021 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | methyl 4-[[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-methylsulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)N2CCN(C)CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H23N3O5S/c1-17-8-10-18(11-9-17)15(20)12-19(25(3,22)23)14-6-4-13(5-7-14)16(21)24-2/h4-7H,8-12H2,1-3H3 |
| InChIKey | CORPVWSBPWOJRY-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |