C20H24N2O5S — CID 56539379
methyl 4-[methylsulfonyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]amino]benzoate (PubChem CID 56539379) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl 4-[methylsulfonyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]amino]benzoate.
| Compound Name | methyl 4-[methylsulfonyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 56539379 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | methyl 4-[methylsulfonyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N(CC(=O)N(c2ccccc2)C(C)C)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-15(2)22(18-8-6-5-7-9-18)19(23)14-21(28(4,25)26)17-12-10-16(11-13-17)20(24)27-3/h5-13,15H,14H2,1-4H3 |
| InChIKey | AGPVBLRIGUBBQC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |