C16H25ClN2O5S — CID 113157009
2-(4-chloro-2,5-dimethoxy-N-methylsulfonylanilino)-N-pentylacetamide (PubChem CID 113157009) has the molecular formula C16H25ClN2O5S and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-(4-chloro-2,5-dimethoxy-N-methylsulfonylanilino)-N-pentylacetamide.
| Compound Name | 2-(4-chloro-2,5-dimethoxy-N-methylsulfonylanilino)-N-pentylacetamide |
|---|---|
| PubChem CID | 113157009 |
| Molecular Formula | C16H25ClN2O5S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(4-chloro-2,5-dimethoxy-N-methylsulfonylanilino)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(c1cc(OC)c(Cl)cc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C16H25ClN2O5S/c1-5-6-7-8-18-16(20)11-19(25(4,21)22)13-10-14(23-2)12(17)9-15(13)24-3/h9-10H,5-8,11H2,1-4H3,(H,18,20) |
| InChIKey | XRKBWKFFDPEMHS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|