C12H18N4O5S — CID 113157747
N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 113157747) has the molecular formula C12H18N4O5S and a molecular weight of 330.37 g/mol. Its IUPAC name is N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide.
| Compound Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 113157747 |
| Molecular Formula | C12H18N4O5S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | Cc1cc(N(CC(=O)N2CCN(C=O)CC2)S(C)(=O)=O)no1 |
| InChI | InChI=1S/C12H18N4O5S/c1-10-7-11(13-21-10)16(22(2,19)20)8-12(18)15-5-3-14(9-17)4-6-15/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | SCOZLKBCVOGFLD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|