C17H25N3O5S — CID 30272318
N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)methanesulfonamide (PubChem CID 30272318) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)methanesulfonamide.
| Compound Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 30272318 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]-N-(4-propan-2-yloxyphenyl)methanesulfonamide |
| SMILES | CC(C)Oc1ccc(N(CC(=O)N2CCN(C=O)CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H25N3O5S/c1-14(2)25-16-6-4-15(5-7-16)20(26(3,23)24)12-17(22)19-10-8-18(13-21)9-11-19/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | VGPNPJCGOOAKKT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|