C22H17Cl2NOS — CID 11315951
(3R,4R)-3-chloro-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanylazetidin-2-one (PubChem CID 11315951) has the molecular formula C22H17Cl2NOS and a molecular weight of 414.36 g/mol. Its IUPAC name is (3R,4R)-3-chloro-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanylazetidin-2-one.
| Compound Name | (3R,4R)-3-chloro-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 11315951 |
| Molecular Formula | C22H17Cl2NOS |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | (3R,4R)-3-chloro-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanylazetidin-2-one |
| SMILES | Cc1ccc(N2C(=O)[C@@](Cl)(Sc3ccccc3)[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H17Cl2NOS/c1-15-7-13-18(14-8-15)25-20(16-9-11-17(23)12-10-16)22(24,21(25)26)27-19-5-3-2-4-6-19/h2-14,20H,1H3/t20-,22+/m1/s1 |
| InChIKey | HFGATHCNLNUINK-IRLDBZIGSA-N |
| XLogP | 6.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|