C25H22ClNOS — CID 11270096
(3S,4R)-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanyl-3-prop-2-enylazetidin-2-one (PubChem CID 11270096) has the molecular formula C25H22ClNOS and a molecular weight of 419.98 g/mol. Its IUPAC name is (3S,4R)-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanyl-3-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4R)-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanyl-3-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11270096 |
| Molecular Formula | C25H22ClNOS |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3S,4R)-4-(4-chlorophenyl)-1-(4-methylphenyl)-3-phenylsulfanyl-3-prop-2-enylazetidin-2-one |
| SMILES | C=CC[C@@]1(Sc2ccccc2)C(=O)N(c2ccc(C)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClNOS/c1-3-17-25(29-22-7-5-4-6-8-22)23(19-11-13-20(26)14-12-19)27(24(25)28)21-15-9-18(2)10-16-21/h3-16,23H,1,17H2,2H3/t23-,25+/m1/s1 |
| InChIKey | SREJQXZJRJAJQE-NOZRDPDXSA-N |
| XLogP | 6.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|