C15H26N2O3 — CID 113160273
N-[2-(azepan-1-yl)-2-oxoethyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 113160273) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-oxoethyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-[2-(azepan-1-yl)-2-oxoethyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 113160273 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-oxoethyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(=O)N(CC(=O)N1CCCCCC1)CC1CCCO1 |
| InChI | InChI=1S/C15H26N2O3/c1-13(18)17(11-14-7-6-10-20-14)12-15(19)16-8-4-2-3-5-9-16/h14H,2-12H2,1H3 |
| InChIKey | NKUYJKFCSSJNQK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |