C22H29N3O3 — CID 97219655
2,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-indole-5-carboxamide (PubChem CID 97219655) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 97219655 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2,3-dimethyl-N-[[(2R)-oxolan-2-yl]methyl]-N-(2-oxo-2-pyrrolidin-1-ylethyl)-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(CC(=O)N3CCCC3)C[C@H]3CCCO3)cc2c1C |
| InChI | InChI=1S/C22H29N3O3/c1-15-16(2)23-20-8-7-17(12-19(15)20)22(27)25(13-18-6-5-11-28-18)14-21(26)24-9-3-4-10-24/h7-8,12,18,23H,3-6,9-11,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | UJNOIARLJDPENU-GOSISDBHSA-N |
| XLogP | 3.03 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|